C25H48O5Si — CID 134905556
methyl (2R,4S,5S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxononanoate (PubChem CID 134905556) has the molecular formula C25H48O5Si and a molecular weight of 456.74 g/mol. Its IUPAC name is methyl (2R,4S,5S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxononanoate.
| Compound Name | methyl (2R,4S,5S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxononanoate |
|---|---|
| PubChem CID | 134905556 |
| Molecular Formula | C25H48O5Si |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | methyl (2R,4S,5S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-5-hydroxy-2,4,6-trimethyl-7-oxononanoate |
| SMILES | COC(=O)[C@H](C)C[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@@](C)(O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C25H48O5Si/c1-17(16-18(2)23(28)29-8)21(26)19(3)22(27)25(7,20-14-12-11-13-15-20)30-31(9,10)24(4,5)6/h17-21,26H,11-16H2,1-10H3/t17-,18+,19+,21-,25-/m0/s1 |
| InChIKey | CVNQILQSSRKRHO-WGTYUKEMSA-N |
| XLogP | 5.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|