C20H40O5Si — CID 11222974
methyl 2-[(2S,3S,4S,6R)-6-(2-hydroxyethyl)-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 11222974) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4S,6R)-6-(2-hydroxyethyl)-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4S,6R)-6-(2-hydroxyethyl)-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 11222974 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | methyl 2-[(2S,3S,4S,6R)-6-(2-hydroxyethyl)-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](CCO)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C |
| InChI | InChI=1S/C20H40O5Si/c1-13(2)26(14(3)4,15(5)6)25-19-11-17(9-10-21)24-18(16(19)7)12-20(22)23-8/h13-19,21H,9-12H2,1-8H3/t16-,17+,18-,19-/m0/s1 |
| InChIKey | GLVLODVOWJKDKY-RDGPPVDQSA-N |
| XLogP | 4.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|