C18H36O4Si — CID 135012526
(3R,4S,5S,6S)-6-(2-hydroxyethyl)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyoxan-2-one (PubChem CID 135012526) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (3R,4S,5S,6S)-6-(2-hydroxyethyl)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyoxan-2-one.
| Compound Name | (3R,4S,5S,6S)-6-(2-hydroxyethyl)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyoxan-2-one |
|---|---|
| PubChem CID | 135012526 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3R,4S,5S,6S)-6-(2-hydroxyethyl)-3,5-dimethyl-4-tri(propan-2-yl)silyloxyoxan-2-one |
| SMILES | CC(C)[Si](O[C@H]1[C@@H](C)[C@H](CCO)OC(=O)[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-11(2)23(12(3)4,13(5)6)22-17-14(7)16(9-10-19)21-18(20)15(17)8/h11-17,19H,9-10H2,1-8H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | WZLWLXDHSLNIRD-YVSFHVDLSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|