C25H52O3Si — CID 138970754
tert-butyl (6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradecanoate (PubChem CID 138970754) has the molecular formula C25H52O3Si and a molecular weight of 428.77 g/mol. Its IUPAC name is tert-butyl (6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradecanoate.
| Compound Name | tert-butyl (6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradecanoate |
|---|---|
| PubChem CID | 138970754 |
| Molecular Formula | C25H52O3Si |
| Molecular Weight | 428.77 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | tert-butyl (6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradecanoate |
| SMILES | CCCCC[C@H](CC[C@H](C)CCCCC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O3Si/c1-11-12-13-17-22(28-29(9,10)25(6,7)8)20-19-21(2)16-14-15-18-23(26)27-24(3,4)5/h21-22H,11-20H2,1-10H3/t21-,22-/m1/s1 |
| InChIKey | OZKHHFYISFBZAP-FGZHOGPDSA-N |
| XLogP | 8.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.77 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|