C20H36O3Si2 — CID 155932455
2-trimethylsilylethyl 2-methyl-5-oxo-2-(5-trimethylsilylpent-4-ynyl)cyclopentane-1-carboxylate (PubChem CID 155932455) has the molecular formula C20H36O3Si2 and a molecular weight of 380.68 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-methyl-5-oxo-2-(5-trimethylsilylpent-4-ynyl)cyclopentane-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 2-methyl-5-oxo-2-(5-trimethylsilylpent-4-ynyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 155932455 |
| Molecular Formula | C20H36O3Si2 |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-trimethylsilylethyl 2-methyl-5-oxo-2-(5-trimethylsilylpent-4-ynyl)cyclopentane-1-carboxylate |
| SMILES | CC1(CCCC#C[Si](C)(C)C)CCC(=O)C1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C20H36O3Si2/c1-20(12-9-8-10-15-24(2,3)4)13-11-17(21)18(20)19(22)23-14-16-25(5,6)7/h18H,8-9,11-14,16H2,1-7H3 |
| InChIKey | YBKAHTXODDCFFZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|