C19H34O4Si — CID 102303647
diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)heptan-2-yl]propanedioate (PubChem CID 102303647) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)heptan-2-yl]propanedioate.
| Compound Name | diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)heptan-2-yl]propanedioate |
|---|---|
| PubChem CID | 102303647 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | diethyl 2-[(2S,3R)-3-(2-trimethylsilylethynyl)heptan-2-yl]propanedioate |
| SMILES | CCCC[C@@H](C#C[Si](C)(C)C)[C@H](C)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H34O4Si/c1-8-11-12-16(13-14-24(5,6)7)15(4)17(18(20)22-9-2)19(21)23-10-3/h15-17H,8-12H2,1-7H3/t15-,16-/m0/s1 |
| InChIKey | YPRCMOUUCRUQBQ-HOTGVXAUSA-N |
| XLogP | 4.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|