C31H58O4SiSn — CID 10699334
dimethyl (4E)-3-(2-methyl-4-trimethylsilylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 10699334) has the molecular formula C31H58O4SiSn and a molecular weight of 641.60 g/mol. Its IUPAC name is dimethyl (4E)-3-(2-methyl-4-trimethylsilylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-(2-methyl-4-trimethylsilylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10699334 |
| Molecular Formula | C31H58O4SiSn |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | dimethyl (4E)-3-(2-methyl-4-trimethylsilylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(CC(C)(C)C1CC(C(=O)OC)(C(=O)OC)C/C1=C\[Sn](CCCC)(CCCC)CCCC)[Si](C)(C)C |
| InChI | InChI=1S/C19H31O4Si.3C4H9.Sn/c1-13-10-19(16(20)22-5,17(21)23-6)12-15(13)18(3,4)11-14(2)24(7,8)9;3*1-3-4-2;/h1,15H,2,10-12H2,3-9H3;3*1,3-4H2,2H3; |
| InChIKey | GQJGWBKAPVXFNZ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|