C17H26O4 — CID 102368832
cis-dimethyl (2S,4R)-4-ethenyl-3-methylidene-2-pentylcyclopentane-1,1-dicarboxylate (PubChem CID 102368832) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is cis-dimethyl (2S,4R)-4-ethenyl-3-methylidene-2-pentylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2S,4R)-4-ethenyl-3-methylidene-2-pentylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102368832 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | cis-dimethyl (2S,4R)-4-ethenyl-3-methylidene-2-pentylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](CCCCC)C1=C |
| InChI | InChI=1S/C17H26O4/c1-6-8-9-10-14-12(3)13(7-2)11-17(14,15(18)20-4)16(19)21-5/h7,13-14H,2-3,6,8-11H2,1,4-5H3/t13-,14-/m0/s1 |
| InChIKey | UHWJTRASLIYGKM-KBPBESRZSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|