C19H30O6Si — CID 11036349
dimethyl (3E,4Z)-3-(2-methoxy-2-oxoethylidene)-4-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 11036349) has the molecular formula C19H30O6Si and a molecular weight of 382.53 g/mol. Its IUPAC name is dimethyl (3E,4Z)-3-(2-methoxy-2-oxoethylidene)-4-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,4Z)-3-(2-methoxy-2-oxoethylidene)-4-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11036349 |
| Molecular Formula | C19H30O6Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | dimethyl (3E,4Z)-3-(2-methoxy-2-oxoethylidene)-4-(triethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CC[Si](/C=C1/CC(C(=O)OC)(C(=O)OC)C/C1=C\C(=O)OC)(CC)CC |
| InChI | InChI=1S/C19H30O6Si/c1-7-26(8-2,9-3)13-15-12-19(17(21)24-5,18(22)25-6)11-14(15)10-16(20)23-4/h10,13H,7-9,11-12H2,1-6H3/b14-10+,15-13- |
| InChIKey | KOMHCKCOIPIOJY-BZTGPAQBSA-N |
| XLogP | 3.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|