C29H58O3SiSn — CID 71480971
methyl (3R,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-7-tributylstannylhepta-4,6-dienoate (PubChem CID 71480971) has the molecular formula C29H58O3SiSn and a molecular weight of 601.58 g/mol. Its IUPAC name is methyl (3R,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-7-tributylstannylhepta-4,6-dienoate.
| Compound Name | methyl (3R,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-7-tributylstannylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 71480971 |
| Molecular Formula | C29H58O3SiSn |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | methyl (3R,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-7-tributylstannylhepta-4,6-dienoate |
| SMILES | CCCC[Sn](/C=C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)OC)(CCCC)CCCC |
| InChI | InChI=1S/C17H31O3Si.3C4H9.Sn/c1-11-12-13(2)14(17(6,7)15(18)19-8)20-21(9,10)16(3,4)5;3*1-3-4-2;/h1,11-12,14H,2-10H3;3*1,3-4H2,2H3;/b11-1?,13-12+;;;;/t14-;;;;/m1..../s1 |
| InChIKey | ALHKLBMJXKDHJX-LEXGTPTFSA-N |
| XLogP | 9.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|