C25H46O3Si — CID 11396110
ethyl (4E,6S,9E,11R)-4,6,10-trimethyl-8-methylidene-11-triethylsilyloxytrideca-4,9-dienoate (PubChem CID 11396110) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is ethyl (4E,6S,9E,11R)-4,6,10-trimethyl-8-methylidene-11-triethylsilyloxytrideca-4,9-dienoate.
| Compound Name | ethyl (4E,6S,9E,11R)-4,6,10-trimethyl-8-methylidene-11-triethylsilyloxytrideca-4,9-dienoate |
|---|---|
| PubChem CID | 11396110 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | ethyl (4E,6S,9E,11R)-4,6,10-trimethyl-8-methylidene-11-triethylsilyloxytrideca-4,9-dienoate |
| SMILES | C=C(/C=C(\C)[C@@H](CC)O[Si](CC)(CC)CC)C[C@H](C)/C=C(\C)CCC(=O)OCC |
| InChI | InChI=1S/C25H46O3Si/c1-10-24(28-29(12-3,13-4)14-5)23(9)19-22(8)18-21(7)17-20(6)15-16-25(26)27-11-2/h17,19,21,24H,8,10-16,18H2,1-7,9H3/b20-17+,23-19+/t21-,24-/m1/s1 |
| InChIKey | WFBNJJCWLJLVDO-WHWUFACPSA-N |
| XLogP | 7.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|