C18H36O3Si — CID 11045712
(E,2S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoic acid (PubChem CID 11045712) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (E,2S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoic acid.
| Compound Name | (E,2S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoic acid |
|---|---|
| PubChem CID | 11045712 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (E,2S,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoic acid |
| SMILES | C/C(=C\[C@H](C)C[C@H](C)O[Si](C)(C)C(C)(C)C)C[C@H](C)C(=O)O |
| InChI | InChI=1S/C18H36O3Si/c1-13(11-15(3)17(19)20)10-14(2)12-16(4)21-22(8,9)18(5,6)7/h10,14-16H,11-12H2,1-9H3,(H,19,20)/b13-10+/t14-,15-,16-/m0/s1 |
| InChIKey | FYYJQJQKGYGJGC-CWFABOFTSA-N |
| XLogP | 5.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|