C18H36O3Si — CID 91142109
(7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-enoic acid (PubChem CID 91142109) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-enoic acid.
| Compound Name | (7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-enoic acid |
|---|---|
| PubChem CID | 91142109 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (7S)-5-methyl-7-tri(propan-2-yl)silyloxyoct-4-enoic acid |
| SMILES | CC(=CCCC(=O)O)C[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-13(2)22(14(3)4,15(5)6)21-17(8)12-16(7)10-9-11-18(19)20/h10,13-15,17H,9,11-12H2,1-8H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | HGTKASOQYZJBCR-KRWDZBQOSA-N |
| XLogP | 5.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|