C24H48O5Si2 — CID 21185316
5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoic acid (PubChem CID 21185316) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoic acid.
| Compound Name | 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoic acid |
|---|---|
| PubChem CID | 21185316 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 5-[[[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-dimethylsilyl]oxy-dimethylsilyl]pentanoic acid |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCC(=O)O |
| InChI | InChI=1S/C24H48O5Si2/c1-21(2)13-12-14-22(3)17-18-28-24(27)16-9-11-20-31(6,7)29-30(4,5)19-10-8-15-23(25)26/h13,22H,8-12,14-20H2,1-7H3,(H,25,26) |
| InChIKey | ZEDQRRJMMQQSJF-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|