C54H102O12Si4 — CID 21185318
5-[4,6,8-tris[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]pentanoic acid (PubChem CID 21185318) has the molecular formula C54H102O12Si4 and a molecular weight of 1055.74 g/mol. Its IUPAC name is 5-[4,6,8-tris[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]pentanoic acid.
| Compound Name | 5-[4,6,8-tris[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 21185318 |
| Molecular Formula | C54H102O12Si4 |
| Molecular Weight | 1055.74 g/mol |
| Exact Mass | 1054.64 |
| IUPAC Name | 5-[4,6,8-tris[5-(3,7-dimethyloct-6-enoxy)-5-oxopentyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]pentanoic acid |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCCC[Si]1(C)O[Si](C)(CCCCC(=O)O)O[Si](C)(CCCCC(=O)OCCC(C)CCC=C(C)C)O[Si](C)(CCCCC(=O)OCCC(C)CCC=C(C)C)O1 |
| InChI | InChI=1S/C54H102O12Si4/c1-45(2)25-22-28-48(7)35-38-60-52(57)32-15-19-42-68(11)63-67(10,41-18-14-31-51(55)56)64-69(12,43-20-16-33-53(58)61-39-36-49(8)29-23-26-46(3)4)66-70(13,65-68)44-21-17-34-54(59)62-40-37-50(9)30-24-27-47(5)6/h25-27,48-50H,14-24,28-44H2,1-13H3,(H,55,56) |
| InChIKey | ANBQFECCSQIMTC-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.74 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|