C20H40O3Si — CID 125295114
ethyl (E,2R,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoate (PubChem CID 125295114) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is ethyl (E,2R,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoate.
| Compound Name | ethyl (E,2R,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoate |
|---|---|
| PubChem CID | 125295114 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | ethyl (E,2R,6R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-enoate |
| SMILES | CCOC(=O)[C@H](C)C/C(C)=C/[C@H](C)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-11-22-19(21)17(4)13-15(2)12-16(3)14-18(5)23-24(9,10)20(6,7)8/h12,16-18H,11,13-14H2,1-10H3/b15-12+/t16-,17+,18-/m0/s1 |
| InChIKey | NFBRSOAOWIRVBV-ZTVAONNTSA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|