C22H43IO3Si — CID 42600669
tert-butyl (Z,2R,3R,4S)-6-iodo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhept-5-enoate (PubChem CID 42600669) has the molecular formula C22H43IO3Si and a molecular weight of 510.57 g/mol. Its IUPAC name is tert-butyl (Z,2R,3R,4S)-6-iodo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhept-5-enoate.
| Compound Name | tert-butyl (Z,2R,3R,4S)-6-iodo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhept-5-enoate |
|---|---|
| PubChem CID | 42600669 |
| Molecular Formula | C22H43IO3Si |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | tert-butyl (Z,2R,3R,4S)-6-iodo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhept-5-enoate |
| SMILES | C/C(I)=C/[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H43IO3Si/c1-14(2)27(15(3)4,16(5)6)26-20(17(7)13-18(8)23)19(9)21(24)25-22(10,11)12/h13-17,19-20H,1-12H3/b18-13-/t17-,19+,20+/m0/s1 |
| InChIKey | SBYULDYPLGSJKP-NFIYMKGCSA-N |
| XLogP | 7.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|