C18H38O3Si2 — CID 101404342
methyl (Z)-2-methyl-4-(trimethylsilylmethyl)-3-trimethylsilyloxynon-4-enoate (PubChem CID 101404342) has the molecular formula C18H38O3Si2 and a molecular weight of 358.67 g/mol. Its IUPAC name is methyl (Z)-2-methyl-4-(trimethylsilylmethyl)-3-trimethylsilyloxynon-4-enoate.
| Compound Name | methyl (Z)-2-methyl-4-(trimethylsilylmethyl)-3-trimethylsilyloxynon-4-enoate |
|---|---|
| PubChem CID | 101404342 |
| Molecular Formula | C18H38O3Si2 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | methyl (Z)-2-methyl-4-(trimethylsilylmethyl)-3-trimethylsilyloxynon-4-enoate |
| SMILES | CCCC/C=C(\C[Si](C)(C)C)C(O[Si](C)(C)C)C(C)C(=O)OC |
| InChI | InChI=1S/C18H38O3Si2/c1-10-11-12-13-16(14-22(4,5)6)17(21-23(7,8)9)15(2)18(19)20-3/h13,15,17H,10-12,14H2,1-9H3/b16-13+ |
| InChIKey | JFBIAPODJDOKOY-DTQAZKPQSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|