C17H29IO3Si — CID 134887289
methyl (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhept-4-en-6-ynoate (PubChem CID 134887289) has the molecular formula C17H29IO3Si and a molecular weight of 436.41 g/mol. Its IUPAC name is methyl (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhept-4-en-6-ynoate.
| Compound Name | methyl (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhept-4-en-6-ynoate |
|---|---|
| PubChem CID | 134887289 |
| Molecular Formula | C17H29IO3Si |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | methyl (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhept-4-en-6-ynoate |
| SMILES | COC(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C\C#CI |
| InChI | InChI=1S/C17H29IO3Si/c1-13(11-10-12-18)14(17(5,6)15(19)20-7)21-22(8,9)16(2,3)4/h11,14H,1-9H3/b13-11-/t14-/m0/s1 |
| InChIKey | PCAIAUWNZVPSLM-FZDNWWAKSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|