C14H24O3Si — CID 71479546
methyl (Z,3R)-3-hydroxy-2,2,4-trimethyl-7-trimethylsilylhept-4-en-6-ynoate (PubChem CID 71479546) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is methyl (Z,3R)-3-hydroxy-2,2,4-trimethyl-7-trimethylsilylhept-4-en-6-ynoate.
| Compound Name | methyl (Z,3R)-3-hydroxy-2,2,4-trimethyl-7-trimethylsilylhept-4-en-6-ynoate |
|---|---|
| PubChem CID | 71479546 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | methyl (Z,3R)-3-hydroxy-2,2,4-trimethyl-7-trimethylsilylhept-4-en-6-ynoate |
| SMILES | COC(=O)C(C)(C)[C@H](O)/C(C)=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H24O3Si/c1-11(9-8-10-18(5,6)7)12(15)14(2,3)13(16)17-4/h9,12,15H,1-7H3/b11-9-/t12-/m1/s1 |
| InChIKey | CJXIVJAFTJGHNT-UCQJPZFISA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|