C15H30O4Si — CID 11601886
ethyl (Z)-6-hydroxy-4-methyl-3-triethylsilyloxyhex-4-enoate (PubChem CID 11601886) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is ethyl (Z)-6-hydroxy-4-methyl-3-triethylsilyloxyhex-4-enoate.
| Compound Name | ethyl (Z)-6-hydroxy-4-methyl-3-triethylsilyloxyhex-4-enoate |
|---|---|
| PubChem CID | 11601886 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethyl (Z)-6-hydroxy-4-methyl-3-triethylsilyloxyhex-4-enoate |
| SMILES | CCOC(=O)CC(O[Si](CC)(CC)CC)/C(C)=C\CO |
| InChI | InChI=1S/C15H30O4Si/c1-6-18-15(17)12-14(13(5)10-11-16)19-20(7-2,8-3)9-4/h10,14,16H,6-9,11-12H2,1-5H3/b13-10- |
| InChIKey | JEYCJYMJAPKYOD-RAXLEYEMSA-N |
| XLogP | 3.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|