C15H28O7Si — CID 87900962
(Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-enedioic acid (PubChem CID 87900962) has the molecular formula C15H28O7Si and a molecular weight of 348.47 g/mol. Its IUPAC name is (Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-enedioic acid.
| Compound Name | (Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-enedioic acid |
|---|---|
| PubChem CID | 87900962 |
| Molecular Formula | C15H28O7Si |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (Z,3S,7S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dihydroxynon-4-enedioic acid |
| SMILES | CC(C)(C)[Si](C)(C)O/C(=C\[C@@H](O)CC(=O)O)C[C@H](O)CC(=O)O |
| InChI | InChI=1S/C15H28O7Si/c1-15(2,3)23(4,5)22-12(6-10(16)8-13(18)19)7-11(17)9-14(20)21/h6,10-11,16-17H,7-9H2,1-5H3,(H,18,19)(H,20,21)/b12-6-/t10-,11+/m1/s1 |
| InChIKey | WXAGIZVGLMOYKD-WFVMDLQDSA-N |
| XLogP | 1.95 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|