C13H26O3Si — CID 10539167
(E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoic acid (PubChem CID 10539167) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoic acid.
| Compound Name | (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 10539167 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoic acid |
| SMILES | C/C=C/[C@@H](O)[C@@H](C(=O)O)[C@@H](C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-7-8-10(14)11(13(15)16)12(9(2)3)17(4,5)6/h7-12,14H,1-6H3,(H,15,16)/b8-7+/t10-,11-,12-/m1/s1 |
| InChIKey | JZSQKMNDHYZHRA-ZIEBMVIYSA-N |
| XLogP | 2.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|