C17H31IO3Si — CID 134980711
methyl (3S,4Z,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhepta-4,6-dienoate (PubChem CID 134980711) has the molecular formula C17H31IO3Si and a molecular weight of 438.42 g/mol. Its IUPAC name is methyl (3S,4Z,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhepta-4,6-dienoate.
| Compound Name | methyl (3S,4Z,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 134980711 |
| Molecular Formula | C17H31IO3Si |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | methyl (3S,4Z,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-7-iodo-2,2,4-trimethylhepta-4,6-dienoate |
| SMILES | COC(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C\C=C/I |
| InChI | InChI=1S/C17H31IO3Si/c1-13(11-10-12-18)14(17(5,6)15(19)20-7)21-22(8,9)16(2,3)4/h10-12,14H,1-9H3/b12-10-,13-11-/t14-/m0/s1 |
| InChIKey | DKZWPRKQXHUJAL-DWQJHICUSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|