C18H34O3Si — CID 23247712
(2S,3R,4Z)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,3,6,7-tetrahydrooxocin-8-one (PubChem CID 23247712) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (2S,3R,4Z)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,3,6,7-tetrahydrooxocin-8-one.
| Compound Name | (2S,3R,4Z)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,3,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 23247712 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2S,3R,4Z)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,3,6,7-tetrahydrooxocin-8-one |
| SMILES | C/C1=C/[C@@H](C)[C@@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)OC(=O)CC1 |
| InChI | InChI=1S/C18H34O3Si/c1-13-9-10-16(19)21-17(14(2)11-13)15(3)12-20-22(7,8)18(4,5)6/h11,14-15,17H,9-10,12H2,1-8H3/b13-11-/t14-,15-,17+/m1/s1 |
| InChIKey | UIYBXYSZAIEMOB-VMHZXUCRSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|