C22H43IO3SiSn — CID 135074517
ethyl (E)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate (PubChem CID 135074517) has the molecular formula C22H43IO3SiSn and a molecular weight of 629.28 g/mol. Its IUPAC name is ethyl (E)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate.
| Compound Name | ethyl (E)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate |
|---|---|
| PubChem CID | 135074517 |
| Molecular Formula | C22H43IO3SiSn |
| Molecular Weight | 629.28 g/mol |
| Exact Mass | 630.10 |
| IUPAC Name | ethyl (E)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate |
| SMILES | C/C=C(/I)CCC(C(=O)OCC)/C(=C/CCO[Si](C)(C)C(C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C19H34IO3Si.3CH3.Sn/c1-8-17(20)14-13-16(18(21)22-9-2)12-10-11-15-23-24(6,7)19(3,4)5;;;;/h8,10,16H,9,11,13-15H2,1-7H3;3*1H3;/b12-10?,17-8+;;;; |
| InChIKey | QFTSBBIJQBYVEN-HSBKHSIISA-N |
| XLogP | 7.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.28 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|