C21H41IO3SiSn — CID 11093313
methyl (Z)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate (PubChem CID 11093313) has the molecular formula C21H41IO3SiSn and a molecular weight of 615.26 g/mol. Its IUPAC name is methyl (Z)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate.
| Compound Name | methyl (Z)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate |
|---|---|
| PubChem CID | 11093313 |
| Molecular Formula | C21H41IO3SiSn |
| Molecular Weight | 615.26 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | methyl (Z)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylstannylbut-1-enyl]-5-iodohept-5-enoate |
| SMILES | C/C=C(\I)CCC(C(=O)OC)/C(=C/CCO[Si](C)(C)C(C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C18H32IO3Si.3CH3.Sn/c1-8-16(19)13-12-15(17(20)21-5)11-9-10-14-22-23(6,7)18(2,3)4;;;;/h8-9,15H,10,12-14H2,1-7H3;3*1H3;/b11-9?,16-8-;;;; |
| InChIKey | HAAFWVGDXKVMKF-OUYUYYPRSA-N |
| XLogP | 7.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.26 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|