C20H38O3Si — CID 102305563
methyl (2S,5E)-6,10-dimethyl-2-(2-trimethylsilylethoxymethyl)undeca-5,9-dienoate (PubChem CID 102305563) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is methyl (2S,5E)-6,10-dimethyl-2-(2-trimethylsilylethoxymethyl)undeca-5,9-dienoate.
| Compound Name | methyl (2S,5E)-6,10-dimethyl-2-(2-trimethylsilylethoxymethyl)undeca-5,9-dienoate |
|---|---|
| PubChem CID | 102305563 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | methyl (2S,5E)-6,10-dimethyl-2-(2-trimethylsilylethoxymethyl)undeca-5,9-dienoate |
| SMILES | COC(=O)[C@@H](CC/C=C(\C)CCC=C(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-17(2)10-8-11-18(3)12-9-13-19(20(21)22-4)16-23-14-15-24(5,6)7/h10,12,19H,8-9,11,13-16H2,1-7H3/b18-12+/t19-/m0/s1 |
| InChIKey | SMLDIBBHFKDBCC-GQEMFKIVSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|