C18H34O5Si — CID 14021593
dimethyl 2-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate (PubChem CID 14021593) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is dimethyl 2-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 14021593 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | dimethyl 2-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate |
| SMILES | COC(=O)C(CC/C(C)=C\CCO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H34O5Si/c1-14(10-9-13-23-24(7,8)18(2,3)4)11-12-15(16(19)21-5)17(20)22-6/h10,15H,9,11-13H2,1-8H3/b14-10- |
| InChIKey | GUCWZWLOXACEHB-UVTDQMKNSA-N |
| XLogP | 4.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|