C16H28O5Si — CID 11416203
dimethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]cycloprop-2-ene-1,1-dicarboxylate (PubChem CID 11416203) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is dimethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]cycloprop-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]cycloprop-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11416203 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | dimethyl 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]cycloprop-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O5Si/c1-15(2,3)22(6,7)21-10-8-9-12-11-16(12,13(17)19-4)14(18)20-5/h11H,8-10H2,1-7H3 |
| InChIKey | KDTMMCFYUZXWGN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|