C16H30O4Si — CID 11243947
diethyl 2-[(Z)-6-trimethylsilylhex-4-enyl]propanedioate (PubChem CID 11243947) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is diethyl 2-[(Z)-6-trimethylsilylhex-4-enyl]propanedioate.
| Compound Name | diethyl 2-[(Z)-6-trimethylsilylhex-4-enyl]propanedioate |
|---|---|
| PubChem CID | 11243947 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | diethyl 2-[(Z)-6-trimethylsilylhex-4-enyl]propanedioate |
| SMILES | CCOC(=O)C(CCC/C=C\C[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C16H30O4Si/c1-6-19-15(17)14(16(18)20-7-2)12-10-8-9-11-13-21(3,4)5/h9,11,14H,6-8,10,12-13H2,1-5H3/b11-9- |
| InChIKey | AGPRZWDEASEKEC-LUAWRHEFSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|