C18H34O5Si — CID 11428323
1-O-methyl 3-O-(2-trimethylsilylethyl) (2R)-2-(3,4-dimethylpent-3-enyl)-2-(methoxymethyl)propanedioate (PubChem CID 11428323) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is 1-O-methyl 3-O-(2-trimethylsilylethyl) (2R)-2-(3,4-dimethylpent-3-enyl)-2-(methoxymethyl)propanedioate.
| Compound Name | 1-O-methyl 3-O-(2-trimethylsilylethyl) (2R)-2-(3,4-dimethylpent-3-enyl)-2-(methoxymethyl)propanedioate |
|---|---|
| PubChem CID | 11428323 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 1-O-methyl 3-O-(2-trimethylsilylethyl) (2R)-2-(3,4-dimethylpent-3-enyl)-2-(methoxymethyl)propanedioate |
| SMILES | COC[C@](CCC(C)=C(C)C)(C(=O)OC)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C18H34O5Si/c1-14(2)15(3)9-10-18(13-21-4,16(19)22-5)17(20)23-11-12-24(6,7)8/h9-13H2,1-8H3/t18-/m1/s1 |
| InChIKey | WZFWYVMIGNTTQN-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|