C21H38O9Si — CID 173404761
dimethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate;propanedioic acid (PubChem CID 173404761) has the molecular formula C21H38O9Si and a molecular weight of 462.61 g/mol. Its IUPAC name is dimethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate;propanedioic acid.
| Compound Name | dimethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate;propanedioic acid |
|---|---|
| PubChem CID | 173404761 |
| Molecular Formula | C21H38O9Si |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | dimethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-3-enyl]propanedioate;propanedioic acid |
| SMILES | COC(=O)C(CCC(C)=CCCO[Si](C)(C)C(C)(C)C)C(=O)OC.O=C(O)CC(=O)O |
| InChI | InChI=1S/C18H34O5Si.C3H4O4/c1-14(10-9-13-23-24(7,8)18(2,3)4)11-12-15(16(19)21-5)17(20)22-6;4-2(5)1-3(6)7/h10,15H,9,11-13H2,1-8H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | USOAMIZGFILFCJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|