C25H42O5Si — CID 101022129
dimethyl (3aR,6R)-8-methyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 101022129) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is dimethyl (3aR,6R)-8-methyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,6R)-8-methyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101022129 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | dimethyl (3aR,6R)-8-methyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(C)C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)C=C[C@H]2C1 |
| InChI | InChI=1S/C25H42O5Si/c1-16(2)31(17(3)4,18(5)6)30-15-20-10-11-21-13-25(23(26)28-8,24(27)29-9)14-22(21)19(7)12-20/h10-11,16-18,20-21H,12-15H2,1-9H3/t20-,21-/m0/s1 |
| InChIKey | GCUDDDIFGILLGR-SFTDATJTSA-N |
| XLogP | 5.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|