C17H26O4Si — CID 101350508
dimethyl (3aS,7R)-7-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 101350508) has the molecular formula C17H26O4Si and a molecular weight of 322.48 g/mol. Its IUPAC name is dimethyl (3aS,7R)-7-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,7R)-7-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101350508 |
| Molecular Formula | C17H26O4Si |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | dimethyl (3aS,7R)-7-trimethylsilyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C[C@H]([Si](C)(C)C)CC=C[C@@H]2C1 |
| InChI | InChI=1S/C17H26O4Si/c1-20-15(18)17(16(19)21-2)10-12-7-6-8-14(22(3,4)5)9-13(12)11-17/h6-7,9,12,14H,8,10-11H2,1-5H3/t12-,14-/m1/s1 |
| InChIKey | PBXNUIRUZNVERQ-TZMCWYRMSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|