C20H36O3Si — CID 10991794
ethyl (E)-3-[(1S,2R)-2-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-1-methylcyclopropyl]-2-methylprop-2-enoate (PubChem CID 10991794) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,2R)-2-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-1-methylcyclopropyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,2R)-2-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-1-methylcyclopropyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10991794 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ethyl (E)-3-[(1S,2R)-2-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-1-methylcyclopropyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@]1(C)C[C@@H]1[C@H]1C[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-9-22-18(21)14(2)11-20(6)12-17(20)16-10-15(16)13-23-24(7,8)19(3,4)5/h11,15-17H,9-10,12-13H2,1-8H3/b14-11+/t15-,16+,17-,20+/m1/s1 |
| InChIKey | LNQOJUARRXNGIS-MCZMSHFUSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|