C28H50O3Si — CID 10874244
ethyl (E)-4-[(1R,2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentyl]-2-methylbut-2-enoate (PubChem CID 10874244) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is ethyl (E)-4-[(1R,2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentyl]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(1R,2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentyl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10874244 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | ethyl (E)-4-[(1R,2S,3R)-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentyl]-2-methylbut-2-enoate |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(C/C=C(\C)C(=O)OCC)[C@H]1CC/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O3Si/c1-12-30-26(29)23(5)15-18-28(9)19-16-24(21(2)3)25(28)14-13-22(4)17-20-31-32(10,11)27(6,7)8/h15,17,24-25H,2,12-14,16,18-20H2,1,3-11H3/b22-17+,23-15+/t24-,25-,28-/m0/s1 |
| InChIKey | JMXWZXNNZKDDEO-PNYFFCIASA-N |
| XLogP | 8.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|