C20H39NO4Si — CID 11132814
ethyl (3E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminooxy)-2,6-dimethylocta-3,6-dienoate (PubChem CID 11132814) has the molecular formula C20H39NO4Si and a molecular weight of 385.62 g/mol. Its IUPAC name is ethyl (3E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminooxy)-2,6-dimethylocta-3,6-dienoate.
| Compound Name | ethyl (3E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminooxy)-2,6-dimethylocta-3,6-dienoate |
|---|---|
| PubChem CID | 11132814 |
| Molecular Formula | C20H39NO4Si |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | ethyl (3E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylaminooxy)-2,6-dimethylocta-3,6-dienoate |
| SMILES | CCOC(=O)C(C)(/C=C/C/C(C)=C\CO[Si](C)(C)C(C)(C)C)ON(C)C |
| InChI | InChI=1S/C20H39NO4Si/c1-11-23-18(22)20(6,25-21(7)8)15-12-13-17(2)14-16-24-26(9,10)19(3,4)5/h12,14-15H,11,13,16H2,1-10H3/b15-12+,17-14- |
| InChIKey | FEUUTALQVBNOSC-ADGNBSQLSA-N |
| XLogP | 4.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|