C22H41BrO3Si — CID 11259743
ethyl (E)-2-bromo-4-[(1S,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-5-propan-2-ylcyclopentyl]but-2-enoate (PubChem CID 11259743) has the molecular formula C22H41BrO3Si and a molecular weight of 461.56 g/mol. Its IUPAC name is ethyl (E)-2-bromo-4-[(1S,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-5-propan-2-ylcyclopentyl]but-2-enoate.
| Compound Name | ethyl (E)-2-bromo-4-[(1S,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-5-propan-2-ylcyclopentyl]but-2-enoate |
|---|---|
| PubChem CID | 11259743 |
| Molecular Formula | C22H41BrO3Si |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | ethyl (E)-2-bromo-4-[(1S,2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-5-propan-2-ylcyclopentyl]but-2-enoate |
| SMILES | CCOC(=O)/C(Br)=C\C[C@H]1[C@@H](C(C)C)CC[C@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41BrO3Si/c1-10-25-20(24)19(23)12-11-18-17(16(2)3)13-14-22(18,7)15-26-27(8,9)21(4,5)6/h12,16-18H,10-11,13-15H2,1-9H3/b19-12+/t17-,18+,22-/m1/s1 |
| InChIKey | SQMUXOSAMMBUSN-FRFUEXIGSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|