C30H56O6Si — CID 14059925
ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-2-methylhex-2-enoate (PubChem CID 14059925) has the molecular formula C30H56O6Si and a molecular weight of 540.86 g/mol. Its IUPAC name is ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-2-methylhex-2-enoate.
| Compound Name | ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 14059925 |
| Molecular Formula | C30H56O6Si |
| Molecular Weight | 540.86 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-2-methylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)CC[C@H]([C@](C)(CCC=C(C)C)OCOC)O1 |
| InChI | InChI=1S/C30H56O6Si/c1-13-33-27(31)24(4)17-14-18-26(36-37(11,12)28(5,6)7)30(9)21-19-25(35-30)29(8,34-22-32-10)20-15-16-23(2)3/h16-17,25-26H,13-15,18-22H2,1-12H3/b24-17+/t25-,26+,29+,30-/m1/s1 |
| InChIKey | VWUOWFZYJSLIHC-HJMDFBRRSA-N |
| XLogP | 7.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.86 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|