C12H21NO3 — CID 11770193
ethyl (E,6R,8Z)-8-hydroxyimino-2,6-dimethyloct-2-enoate (PubChem CID 11770193) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is ethyl (E,6R,8Z)-8-hydroxyimino-2,6-dimethyloct-2-enoate.
| Compound Name | ethyl (E,6R,8Z)-8-hydroxyimino-2,6-dimethyloct-2-enoate |
|---|---|
| PubChem CID | 11770193 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | ethyl (E,6R,8Z)-8-hydroxyimino-2,6-dimethyloct-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@@H](C)C/C=N\O |
| InChI | InChI=1S/C12H21NO3/c1-4-16-12(14)11(3)7-5-6-10(2)8-9-13-15/h7,9-10,15H,4-6,8H2,1-3H3/b11-7+,13-9-/t10-/m1/s1 |
| InChIKey | MEMXCSLOQGPFOI-FSFAZJRJSA-N |
| XLogP | 2.76 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|