C18H34O4Si — CID 11221578
methyl (2R,5R)-2-methyl-5-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]oxolane-2-carboxylate (PubChem CID 11221578) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is methyl (2R,5R)-2-methyl-5-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]oxolane-2-carboxylate.
| Compound Name | methyl (2R,5R)-2-methyl-5-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 11221578 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | methyl (2R,5R)-2-methyl-5-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC[C@H]([C@](C)(CCC=C(C)C)O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C18H34O4Si/c1-14(2)10-9-12-17(3,22-23(6,7)8)15-11-13-18(4,21-15)16(19)20-5/h10,15H,9,11-13H2,1-8H3/t15-,17+,18-/m1/s1 |
| InChIKey | YHUUZCSWLICKGY-BPQIPLTHSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|