C25H29NO6 — CID 70306345
ethyl 2-(16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-21-yl)propanoate (PubChem CID 70306345) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl 2-(16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-21-yl)propanoate.
| Compound Name | ethyl 2-(16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-21-yl)propanoate |
|---|---|
| PubChem CID | 70306345 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | ethyl 2-(16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-21-yl)propanoate |
| SMILES | CCOC(=O)C(C)C1c2ccc(OC)c(OC)c2CN2CCc3cc4c(cc3C12)OCO4 |
| InChI | InChI=1S/C25H29NO6/c1-5-30-25(27)14(2)22-16-6-7-19(28-3)24(29-4)18(16)12-26-9-8-15-10-20-21(32-13-31-20)11-17(15)23(22)26/h6-7,10-11,14,22-23H,5,8-9,12-13H2,1-4H3 |
| InChIKey | LTRWLJBMKWQIBE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |