C33H32N2O6 — CID 66842710
16,17-dimethoxy-21-[3-(4-nitronaphthalen-1-yl)propyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene (PubChem CID 66842710) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is 16,17-dimethoxy-21-[3-(4-nitronaphthalen-1-yl)propyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene.
| Compound Name | 16,17-dimethoxy-21-[3-(4-nitronaphthalen-1-yl)propyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 66842710 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 16,17-dimethoxy-21-[3-(4-nitronaphthalen-1-yl)propyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
| SMILES | COc1ccc2c(c1OC)CN1CCc3cc4c(cc3C1C2CCCc1ccc([N+](=O)[O-])c2ccccc12)OCO4 |
| InChI | InChI=1S/C33H32N2O6/c1-38-29-13-11-23-25(9-5-6-20-10-12-28(35(36)37)24-8-4-3-7-22(20)24)32-26-17-31-30(40-19-41-31)16-21(26)14-15-34(32)18-27(23)33(29)39-2/h3-4,7-8,10-13,16-17,25,32H,5-6,9,14-15,18-19H2,1-2H3 |
| InChIKey | XXZRYZGSLTUJHK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|