C21H25NO4 — CID 15765608
7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene (PubChem CID 15765608) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene.
| Compound Name | 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene |
|---|---|
| PubChem CID | 15765608 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene |
| SMILES | COc1ccc2c(c1OC)CN(C)CCc1cc3c(cc1CC2)OCO3 |
| InChI | InChI=1S/C21H25NO4/c1-22-9-8-16-11-20-19(25-13-26-20)10-15(16)5-4-14-6-7-18(23-2)21(24-3)17(14)12-22/h6-7,10-11H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | AWWKRYDPJVJCSQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |