C20H23NO2 — CID 102295748
(13E)-3,4-dimethoxy-6-methyl-7,8-dihydro-5H-benzo[e][2]benzazecine (PubChem CID 102295748) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (13E)-3,4-dimethoxy-6-methyl-7,8-dihydro-5H-benzo[e][2]benzazecine.
| Compound Name | (13E)-3,4-dimethoxy-6-methyl-7,8-dihydro-5H-benzo[e][2]benzazecine |
|---|---|
| PubChem CID | 102295748 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (13E)-3,4-dimethoxy-6-methyl-7,8-dihydro-5H-benzo[e][2]benzazecine |
| SMILES | COc1ccc2c(c1OC)CN(C)CCc1ccccc1/C=C/2 |
| InChI | InChI=1S/C20H23NO2/c1-21-13-12-16-7-5-4-6-15(16)8-9-17-10-11-19(22-2)20(23-3)18(17)14-21/h4-11H,12-14H2,1-3H3/b9-8+ |
| InChIKey | IGCYVCHSKQRBFM-CMDGGOBGSA-N |
| XLogP | 3.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|