C28H30BNO5 — CID 11605276
CID 11605276 (PubChem CID 11605276) has the molecular formula C28H30BNO5 and a molecular weight of 471.36 g/mol.
| Compound Name | CID 11605276 |
|---|---|
| PubChem CID | 11605276 |
| Molecular Formula | C28H30BNO5 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | — |
| SMILES | [B]C1Cc2ccc(OC)c(OC)c2CN(Cc2ccc(OC)cc2)CCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C28H30BNO5/c1-31-21-7-4-18(5-8-21)15-30-11-10-20-13-26-27(35-17-34-26)14-22(20)24(29)12-19-6-9-25(32-2)28(33-3)23(19)16-30/h4-9,13-14,24H,10-12,15-17H2,1-3H3 |
| InChIKey | RESCGQWZKOHDLS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|