C20H23NO6 — CID 139185766
dimethyl (10bR)-2-(2-ethoxy-2-oxoethyl)-6,10b-dihydro-5H-pyrrolo[2,1-a]isoquinoline-3,3-dicarboxylate (PubChem CID 139185766) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is dimethyl (10bR)-2-(2-ethoxy-2-oxoethyl)-6,10b-dihydro-5H-pyrrolo[2,1-a]isoquinoline-3,3-dicarboxylate.
| Compound Name | dimethyl (10bR)-2-(2-ethoxy-2-oxoethyl)-6,10b-dihydro-5H-pyrrolo[2,1-a]isoquinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 139185766 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | dimethyl (10bR)-2-(2-ethoxy-2-oxoethyl)-6,10b-dihydro-5H-pyrrolo[2,1-a]isoquinoline-3,3-dicarboxylate |
| SMILES | CCOC(=O)CC1=C[C@@H]2c3ccccc3CCN2C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H23NO6/c1-4-27-17(22)12-14-11-16-15-8-6-5-7-13(15)9-10-21(16)20(14,18(23)25-2)19(24)26-3/h5-8,11,16H,4,9-10,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | MECVNQWRZZBOFT-MRXNPFEDSA-N |
| XLogP | 1.56 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|