C20H21NO3 — CID 67811989
ethyl 2-(7-carbamoyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetate (PubChem CID 67811989) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 2-(7-carbamoyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetate.
| Compound Name | ethyl 2-(7-carbamoyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetate |
|---|---|
| PubChem CID | 67811989 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl 2-(7-carbamoyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetate |
| SMILES | CCOC(=O)CC1c2ccccc2CCc2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C20H21NO3/c1-2-24-19(22)12-18-14-7-4-3-6-13(14)10-11-16-15(18)8-5-9-17(16)20(21)23/h3-9,18H,2,10-12H2,1H3,(H2,21,23) |
| InChIKey | KMMIWGSLSXXKMK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |