C27H32O5 — CID 161281738
ethyl 2-(2,3-dihydro-1H-inden-1-yl)acetate;ethyl (E)-2-(2,3-dihydro-1H-inden-1-yl)-3-hydroxyprop-2-enoate (PubChem CID 161281738) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1H-inden-1-yl)acetate;ethyl (E)-2-(2,3-dihydro-1H-inden-1-yl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 2-(2,3-dihydro-1H-inden-1-yl)acetate;ethyl (E)-2-(2,3-dihydro-1H-inden-1-yl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 161281738 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | ethyl 2-(2,3-dihydro-1H-inden-1-yl)acetate;ethyl (E)-2-(2,3-dihydro-1H-inden-1-yl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/O)C1CCc2ccccc21.CCOC(=O)CC1CCc2ccccc21 |
| InChI | InChI=1S/C14H16O3.C13H16O2/c1-2-17-14(16)13(9-15)12-8-7-10-5-3-4-6-11(10)12;1-2-15-13(14)9-11-8-7-10-5-3-4-6-12(10)11/h3-6,9,12,15H,2,7-8H2,1H3;3-6,11H,2,7-9H2,1H3/b13-9+; |
| InChIKey | VFEJFFADTYZZJH-KJEVSKRMSA-N |
| XLogP | 5.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|